What is the Tipepidine hibenzate?

Tipepidine hibenzate is COA, while it's Molecular Formula is C15H17NS2 . C14H10O4. COA Tipepidine Hibenzate is used in solid compositions containing ibuprofen and loratadine. Has pharmaceutical applications.

What is the CAS number for Tipepidine hibenzate?

The CAS number of Tipepidine hibenzate is 31139-87-4.

What is Tipepidine hibenzate (31139-87-4) used for?

Tipepidine hibenzate is a compound with pharmaceutical applications, utilized in the formulation of solid compositions containing ibuprofen and loratadine. It plays a significant role in the pharmaceutical industry due to its ability to enhance the effectiveness of these medications.InChI:InChI=1/C15H17NS2.C14H10O4/c1-16-8-2-5-12(11-16)15(13-6-3-9-17-13)14-7-4-10-18-14;15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h3-4,6-7,9-10H,2,5,8,11H2,1H3;1-8,15H,(H,17,18)

What is the Tipepidine hibenzate?

Tipepidine hibenzate is COA, while it's Molecular Formula is C15H17NS2 . C14H10O4. COA Tipepidine Hibenzate is used in solid compositions containing ibuprofen and loratadine. Has pharmaceutical applications.

What is the CAS number for Tipepidine hibenzate?

The CAS number of Tipepidine hibenzate is 31139-87-4.

What is Tipepidine hibenzate (31139-87-4) used for?

Tipepidine hibenzate is a compound with pharmaceutical applications, utilized in the formulation of solid compositions containing ibuprofen and loratadine. It plays a significant role in the pharmaceutical industry due to its ability to enhance the effectiveness of these medications.InChI:InChI=1/C15H17NS2.C14H10O4/c1-16-8-2-5-12(11-16)15(13-6-3-9-17-13)14-7-4-10-18-14;15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h3-4,6-7,9-10H,2,5,8,11H2,1H3;1-8,15H,(H,17,18)

Excellent chemical plant bulk supply Tipepidine hibenzate 31139-87-4

Current location:Home > Pharmaceutical

Product

Tipepidine hibenzate

CAS No.: 31139-87-4
Purity: 99%

inquiry

Excellent chemical plant bulk supply Tipepidine hibenzate 31139-87-4

Molecular Formula: C15H17NS2^.C14H10O4
Molecular Weight: 517.67
Appearance/Colour: COA
Vapor Pressure: 1.05E-06mmHg at 25°C
Melting Point: 187-190°
Boiling Point: 403 °C at 760 mmHg
Flash Point: 197.5 °C
PSA： 134.32000
Density: 1.193g/cm3
LogP: 6.59640

Tipepidine hibenzate(Cas 31139-87-4) Usage

InChI:InChI=1/C15H17NS2.C14H10O4/c1-16-8-2-5-12(11-16)15(13-6-3-9-17-13)14-7-4-10-18-14;15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h3-4,6-7,9-10H,2,5,8,11H2,1H3;1-8,15H,(H,17,18)